About diethoxy(dimethyl)silane;ethoxy(trimethyl)silane
diethoxy(dimethyl)silane;ethoxy(trimethyl)silane (PubChem CID 87282566) has the molecular formula C11H30O3Si2
and a molecular weight of 266.53 g/mol. Its IUPAC name is diethoxy(dimethyl)silane;ethoxy(trimethyl)silane.
Molecular Properties
| Compound Name | diethoxy(dimethyl)silane;ethoxy(trimethyl)silane |
| PubChem CID | 87282566 |
| Molecular Formula | C11H30O3Si2 |
| Molecular Weight | 266.53 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | diethoxy(dimethyl)silane;ethoxy(trimethyl)silane |
| SMILES | CCO[Si](C)(C)C.CCO[Si](C)(C)OCC |
| InChI | InChI=1S/C6H16O2Si.C5H14OSi/c1-5-7-9(3,4)8-6-2;1-5-6-7(2,3)4/h5-6H2,1-4H3;5H2,1-4H3 |
| InChIKey | ZIHSJUOHJPTQSC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.53 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze diethoxy(dimethyl)silane;ethoxy(trimethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxy(dimethyl)silane;ethoxy(trimethyl)silane?
The IUPAC name of diethoxy(dimethyl)silane;ethoxy(trimethyl)silane (CID 87282566) is diethoxy(dimethyl)silane;ethoxy(trimethyl)silane.
What is the SMILES notation for diethoxy(dimethyl)silane;ethoxy(trimethyl)silane?
The canonical SMILES for diethoxy(dimethyl)silane;ethoxy(trimethyl)silane is CCO[Si](C)(C)C.CCO[Si](C)(C)OCC.
What is the InChIKey of diethoxy(dimethyl)silane;ethoxy(trimethyl)silane?
The InChIKey is ZIHSJUOHJPTQSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16O2Si.C5H14OSi/c1-5-7-9(3,4)8-6-2;1-5-6-7(2,3)4/h5-6H2,1-4H3;5H2,1-4H3.
What are the key properties of diethoxy(dimethyl)silane;ethoxy(trimethyl)silane?
diethoxy(dimethyl)silane;ethoxy(trimethyl)silane has a molecular weight of 266.53 g/mol, XLogP of 3.62, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxy(dimethyl)silane;ethoxy(trimethyl)silane is sourced from PubChem (CID 87282566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).