diethoxy(dimethyl)silane;prop-2-enoic acid

C9H20O4Si — CID 87574269

IUPACdiethoxy(dimethyl)silane;prop-2-enoic acid
SMILESC=CC(=O)O.CCO[Si](C)(C)OCC
InChIInChI=1S/C6H16O2Si.C3H4O2/c1-5-7-9(3,4)8-6-2;1-2-3(4)5/h5-6H2,1-4H3;2H,1H2,(H,4,5)
InChIKeyKHONYYRPPWCKCZ-UHFFFAOYSA-N
MW220.34 g/mol
LogP2.02
Rot. Bonds5

About diethoxy(dimethyl)silane;prop-2-enoic acid

diethoxy(dimethyl)silane;prop-2-enoic acid (PubChem CID 87574269) has the molecular formula C9H20O4Si and a molecular weight of 220.34 g/mol. Its IUPAC name is diethoxy(dimethyl)silane;prop-2-enoic acid.

Molecular Properties

Compound Namediethoxy(dimethyl)silane;prop-2-enoic acid
PubChem CID87574269
Molecular FormulaC9H20O4Si
Molecular Weight220.34 g/mol
Exact Mass220.11
IUPAC Namediethoxy(dimethyl)silane;prop-2-enoic acid
SMILESC=CC(=O)O.CCO[Si](C)(C)OCC
InChIInChI=1S/C6H16O2Si.C3H4O2/c1-5-7-9(3,4)8-6-2;1-2-3(4)5/h5-6H2,1-4H3;2H,1H2,(H,4,5)
InChIKeyKHONYYRPPWCKCZ-UHFFFAOYSA-N
XLogP2.02
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500220.34
LogP ≤ 52.02
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze diethoxy(dimethyl)silane;prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of diethoxy(dimethyl)silane;prop-2-enoic acid?
The IUPAC name of diethoxy(dimethyl)silane;prop-2-enoic acid (CID 87574269) is diethoxy(dimethyl)silane;prop-2-enoic acid.
What is the SMILES notation for diethoxy(dimethyl)silane;prop-2-enoic acid?
The canonical SMILES for diethoxy(dimethyl)silane;prop-2-enoic acid is C=CC(=O)O.CCO[Si](C)(C)OCC.
What is the InChIKey of diethoxy(dimethyl)silane;prop-2-enoic acid?
The InChIKey is KHONYYRPPWCKCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16O2Si.C3H4O2/c1-5-7-9(3,4)8-6-2;1-2-3(4)5/h5-6H2,1-4H3;2H,1H2,(H,4,5).
What are the key properties of diethoxy(dimethyl)silane;prop-2-enoic acid?
diethoxy(dimethyl)silane;prop-2-enoic acid has a molecular weight of 220.34 g/mol, XLogP of 2.02, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxy(dimethyl)silane;prop-2-enoic acid is sourced from PubChem (CID 87574269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).