About diethoxy(dimethyl)silane;prop-2-enoic acid
diethoxy(dimethyl)silane;prop-2-enoic acid (PubChem CID 87574269) has the molecular formula C9H20O4Si
and a molecular weight of 220.34 g/mol. Its IUPAC name is diethoxy(dimethyl)silane;prop-2-enoic acid.
Molecular Properties
| Compound Name | diethoxy(dimethyl)silane;prop-2-enoic acid |
| PubChem CID | 87574269 |
| Molecular Formula | C9H20O4Si |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | diethoxy(dimethyl)silane;prop-2-enoic acid |
| SMILES | C=CC(=O)O.CCO[Si](C)(C)OCC |
| InChI | InChI=1S/C6H16O2Si.C3H4O2/c1-5-7-9(3,4)8-6-2;1-2-3(4)5/h5-6H2,1-4H3;2H,1H2,(H,4,5) |
| InChIKey | KHONYYRPPWCKCZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze diethoxy(dimethyl)silane;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxy(dimethyl)silane;prop-2-enoic acid?
The IUPAC name of diethoxy(dimethyl)silane;prop-2-enoic acid (CID 87574269) is diethoxy(dimethyl)silane;prop-2-enoic acid.
What is the SMILES notation for diethoxy(dimethyl)silane;prop-2-enoic acid?
The canonical SMILES for diethoxy(dimethyl)silane;prop-2-enoic acid is C=CC(=O)O.CCO[Si](C)(C)OCC.
What is the InChIKey of diethoxy(dimethyl)silane;prop-2-enoic acid?
The InChIKey is KHONYYRPPWCKCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16O2Si.C3H4O2/c1-5-7-9(3,4)8-6-2;1-2-3(4)5/h5-6H2,1-4H3;2H,1H2,(H,4,5).
What are the key properties of diethoxy(dimethyl)silane;prop-2-enoic acid?
diethoxy(dimethyl)silane;prop-2-enoic acid has a molecular weight of 220.34 g/mol, XLogP of 2.02, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxy(dimethyl)silane;prop-2-enoic acid is sourced from PubChem (CID 87574269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).