About prop-2-enoic acid;1,1,1-triethoxypropane
prop-2-enoic acid;1,1,1-triethoxypropane (PubChem CID 174826427) has the molecular formula C12H24O5
and a molecular weight of 248.32 g/mol. Its IUPAC name is prop-2-enoic acid;1,1,1-triethoxypropane.
Molecular Properties
| Compound Name | prop-2-enoic acid;1,1,1-triethoxypropane |
| PubChem CID | 174826427 |
| Molecular Formula | C12H24O5 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | prop-2-enoic acid;1,1,1-triethoxypropane |
| SMILES | C=CC(=O)O.CCOC(CC)(OCC)OCC |
| InChI | InChI=1S/C9H20O3.C3H4O2/c1-5-9(10-6-2,11-7-3)12-8-4;1-2-3(4)5/h5-8H2,1-4H3;2H,1H2,(H,4,5) |
| InChIKey | UPGPLUPSBHPMGM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enoic acid;1,1,1-triethoxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enoic acid;1,1,1-triethoxypropane?
The IUPAC name of prop-2-enoic acid;1,1,1-triethoxypropane (CID 174826427) is prop-2-enoic acid;1,1,1-triethoxypropane.
What is the SMILES notation for prop-2-enoic acid;1,1,1-triethoxypropane?
The canonical SMILES for prop-2-enoic acid;1,1,1-triethoxypropane is C=CC(=O)O.CCOC(CC)(OCC)OCC.
What is the InChIKey of prop-2-enoic acid;1,1,1-triethoxypropane?
The InChIKey is UPGPLUPSBHPMGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O3.C3H4O2/c1-5-9(10-6-2,11-7-3)12-8-4;1-2-3(4)5/h5-8H2,1-4H3;2H,1H2,(H,4,5).
What are the key properties of prop-2-enoic acid;1,1,1-triethoxypropane?
prop-2-enoic acid;1,1,1-triethoxypropane has a molecular weight of 248.32 g/mol, XLogP of 2.42, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enoic acid;1,1,1-triethoxypropane is sourced from PubChem (CID 174826427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).