C11H26O4Si2 — CID 87618283
ethenyl-dimethoxy-methylsilane;ethenyl-ethyl-dimethoxysilane (PubChem CID 87618283) has the molecular formula C11H26O4Si2 and a molecular weight of 278.50 g/mol. Its IUPAC name is ethenyl-dimethoxy-methylsilane;ethenyl-ethyl-dimethoxysilane.
| Compound Name | ethenyl-dimethoxy-methylsilane;ethenyl-ethyl-dimethoxysilane |
|---|---|
| PubChem CID | 87618283 |
| Molecular Formula | C11H26O4Si2 |
| Molecular Weight | 278.50 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | ethenyl-dimethoxy-methylsilane;ethenyl-ethyl-dimethoxysilane |
| SMILES | C=C[Si](C)(OC)OC.C=C[Si](CC)(OC)OC |
| InChI | InChI=1S/C6H14O2Si.C5H12O2Si/c1-5-9(6-2,7-3)8-4;1-5-8(4,6-2)7-3/h5H,1,6H2,2-4H3;5H,1H2,2-4H3 |
| InChIKey | UULQTTYYRHNGIG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.50 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|