About ethenyl(triethoxy)silane;platinum
ethenyl(triethoxy)silane;platinum (PubChem CID 159730516) has the molecular formula C8H18O3PtSi
and a molecular weight of 385.39 g/mol. Its IUPAC name is ethenyl(triethoxy)silane;platinum.
Molecular Properties
| Compound Name | ethenyl(triethoxy)silane;platinum |
| PubChem CID | 159730516 |
| Molecular Formula | C8H18O3PtSi |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | ethenyl(triethoxy)silane;platinum |
| SMILES | C=C[Si](OCC)(OCC)OCC.[Pt] |
| InChI | InChI=1S/C8H18O3Si.Pt/c1-5-9-12(8-4,10-6-2)11-7-3;/h8H,4-7H2,1-3H3; |
| InChIKey | NBEHNXAVKIQSRN-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethenyl(triethoxy)silane;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl(triethoxy)silane;platinum?
The IUPAC name of ethenyl(triethoxy)silane;platinum (CID 159730516) is ethenyl(triethoxy)silane;platinum.
What is the SMILES notation for ethenyl(triethoxy)silane;platinum?
The canonical SMILES for ethenyl(triethoxy)silane;platinum is C=C[Si](OCC)(OCC)OCC.[Pt].
What is the InChIKey of ethenyl(triethoxy)silane;platinum?
The InChIKey is NBEHNXAVKIQSRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O3Si.Pt/c1-5-9-12(8-4,10-6-2)11-7-3;/h8H,4-7H2,1-3H3;.
What are the key properties of ethenyl(triethoxy)silane;platinum?
ethenyl(triethoxy)silane;platinum has a molecular weight of 385.39 g/mol, XLogP of 1.76, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl(triethoxy)silane;platinum is sourced from PubChem (CID 159730516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).