C14H30O6Si — CID 172773463
ethenyl-diethoxy-(2,2,2-triethoxyethoxy)silane (PubChem CID 172773463) has the molecular formula C14H30O6Si and a molecular weight of 322.47 g/mol. Its IUPAC name is ethenyl-diethoxy-(2,2,2-triethoxyethoxy)silane.
| Compound Name | ethenyl-diethoxy-(2,2,2-triethoxyethoxy)silane |
|---|---|
| PubChem CID | 172773463 |
| Molecular Formula | C14H30O6Si |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | ethenyl-diethoxy-(2,2,2-triethoxyethoxy)silane |
| SMILES | C=C[Si](OCC)(OCC)OCC(OCC)(OCC)OCC |
| InChI | InChI=1S/C14H30O6Si/c1-7-15-14(16-8-2,17-9-3)13-20-21(12-6,18-10-4)19-11-5/h12H,6-11,13H2,1-5H3 |
| InChIKey | NGRXGXNDCBGDLI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|