About sodium;ethenyl(triethoxy)silane;hydride
sodium;ethenyl(triethoxy)silane;hydride (PubChem CID 173302645) has the molecular formula C8H19NaO3Si
and a molecular weight of 214.31 g/mol. Its IUPAC name is sodium;ethenyl(triethoxy)silane;hydride.
Molecular Properties
| Compound Name | sodium;ethenyl(triethoxy)silane;hydride |
| PubChem CID | 173302645 |
| Molecular Formula | C8H19NaO3Si |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | sodium;ethenyl(triethoxy)silane;hydride |
| SMILES | C=C[Si](OCC)(OCC)OCC.[H-].[Na+] |
| InChI | InChI=1S/C8H18O3Si.Na.H/c1-5-9-12(8-4,10-6-2)11-7-3;;/h8H,4-7H2,1-3H3;;/q;+1;-1 |
| InChIKey | XJHWFMKUPSGVJQ-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze sodium;ethenyl(triethoxy)silane;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;ethenyl(triethoxy)silane;hydride?
The IUPAC name of sodium;ethenyl(triethoxy)silane;hydride (CID 173302645) is sodium;ethenyl(triethoxy)silane;hydride.
What is the SMILES notation for sodium;ethenyl(triethoxy)silane;hydride?
The canonical SMILES for sodium;ethenyl(triethoxy)silane;hydride is C=C[Si](OCC)(OCC)OCC.[H-].[Na+].
What is the InChIKey of sodium;ethenyl(triethoxy)silane;hydride?
The InChIKey is XJHWFMKUPSGVJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O3Si.Na.H/c1-5-9-12(8-4,10-6-2)11-7-3;;/h8H,4-7H2,1-3H3;;/q;+1;-1.
What are the key properties of sodium;ethenyl(triethoxy)silane;hydride?
sodium;ethenyl(triethoxy)silane;hydride has a molecular weight of 214.31 g/mol, XLogP of -1.12, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;ethenyl(triethoxy)silane;hydride is sourced from PubChem (CID 173302645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).