C16H28O10Si — CID 175171477
ethenyl(triethoxy)silane;methyl prop-2-enoate;oxirane-2,3-dicarboxylic acid (PubChem CID 175171477) has the molecular formula C16H28O10Si and a molecular weight of 408.48 g/mol. Its IUPAC name is ethenyl(triethoxy)silane;methyl prop-2-enoate;oxirane-2,3-dicarboxylic acid.
| Compound Name | ethenyl(triethoxy)silane;methyl prop-2-enoate;oxirane-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 175171477 |
| Molecular Formula | C16H28O10Si |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | ethenyl(triethoxy)silane;methyl prop-2-enoate;oxirane-2,3-dicarboxylic acid |
| SMILES | C=CC(=O)OC.C=C[Si](OCC)(OCC)OCC.O=C(O)C1OC1C(=O)O |
| InChI | InChI=1S/C8H18O3Si.C4H4O5.C4H6O2/c1-5-9-12(8-4,10-6-2)11-7-3;5-3(6)1-2(9-1)4(7)8;1-3-4(5)6-2/h8H,4-7H2,1-3H3;1-2H,(H,5,6)(H,7,8);3H,1H2,2H3 |
| InChIKey | GFKILHBOIXNWGK-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 141.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|