About ethenyl(propan-2-yloxy)silane;ethenyl(triethoxy)silane
ethenyl(propan-2-yloxy)silane;ethenyl(triethoxy)silane (PubChem CID 173356060) has the molecular formula C13H30O4Si2
and a molecular weight of 306.55 g/mol. Its IUPAC name is ethenyl(propan-2-yloxy)silane;ethenyl(triethoxy)silane.
Molecular Properties
| Compound Name | ethenyl(propan-2-yloxy)silane;ethenyl(triethoxy)silane |
| PubChem CID | 173356060 |
| Molecular Formula | C13H30O4Si2 |
| Molecular Weight | 306.55 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | ethenyl(propan-2-yloxy)silane;ethenyl(triethoxy)silane |
| SMILES | C=C[SiH2]OC(C)C.C=C[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C8H18O3Si.C5H12OSi/c1-5-9-12(8-4,10-6-2)11-7-3;1-4-7-6-5(2)3/h8H,4-7H2,1-3H3;4-5H,1,7H2,2-3H3 |
| InChIKey | HPWICCMTBXAVGZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.55 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethenyl(propan-2-yloxy)silane;ethenyl(triethoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl(propan-2-yloxy)silane;ethenyl(triethoxy)silane?
The IUPAC name of ethenyl(propan-2-yloxy)silane;ethenyl(triethoxy)silane (CID 173356060) is ethenyl(propan-2-yloxy)silane;ethenyl(triethoxy)silane.
What is the SMILES notation for ethenyl(propan-2-yloxy)silane;ethenyl(triethoxy)silane?
The canonical SMILES for ethenyl(propan-2-yloxy)silane;ethenyl(triethoxy)silane is C=C[SiH2]OC(C)C.C=C[Si](OCC)(OCC)OCC.
What is the InChIKey of ethenyl(propan-2-yloxy)silane;ethenyl(triethoxy)silane?
The InChIKey is HPWICCMTBXAVGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O3Si.C5H12OSi/c1-5-9-12(8-4,10-6-2)11-7-3;1-4-7-6-5(2)3/h8H,4-7H2,1-3H3;4-5H,1,7H2,2-3H3.
What are the key properties of ethenyl(propan-2-yloxy)silane;ethenyl(triethoxy)silane?
ethenyl(propan-2-yloxy)silane;ethenyl(triethoxy)silane has a molecular weight of 306.55 g/mol, XLogP of 2.40, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl(propan-2-yloxy)silane;ethenyl(triethoxy)silane is sourced from PubChem (CID 173356060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).