C12H30O6SSi2 — CID 87153952
[hydroxymethyl-[3-[3-[hydroxymethyl(dimethoxy)silyl]propylsulfanyl]propyl]-methoxysilyl]methanol (PubChem CID 87153952) has the molecular formula C12H30O6SSi2 and a molecular weight of 358.61 g/mol. Its IUPAC name is [hydroxymethyl-[3-[3-[hydroxymethyl(dimethoxy)silyl]propylsulfanyl]propyl]-methoxysilyl]methanol.
| Compound Name | [hydroxymethyl-[3-[3-[hydroxymethyl(dimethoxy)silyl]propylsulfanyl]propyl]-methoxysilyl]methanol |
|---|---|
| PubChem CID | 87153952 |
| Molecular Formula | C12H30O6SSi2 |
| Molecular Weight | 358.61 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | [hydroxymethyl-[3-[3-[hydroxymethyl(dimethoxy)silyl]propylsulfanyl]propyl]-methoxysilyl]methanol |
| SMILES | CO[Si](CO)(CO)CCCSCCC[Si](CO)(OC)OC |
| InChI | InChI=1S/C12H30O6SSi2/c1-16-20(10-13,11-14)8-4-6-19-7-5-9-21(12-15,17-2)18-3/h13-15H,4-12H2,1-3H3 |
| InChIKey | IFMVALRZSGRHGL-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.61 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|