C27H63F9OSi8 — CID 176893296
tris[dimethyl(3,3,3-trifluoropropyl)silyl]-tris[ethyl(dimethyl)silyl]silyloxysilane (PubChem CID 176893296) has the molecular formula C27H63F9OSi8 and a molecular weight of 799.47 g/mol. Its IUPAC name is tris[dimethyl(3,3,3-trifluoropropyl)silyl]-tris[ethyl(dimethyl)silyl]silyloxysilane.
| Compound Name | tris[dimethyl(3,3,3-trifluoropropyl)silyl]-tris[ethyl(dimethyl)silyl]silyloxysilane |
|---|---|
| PubChem CID | 176893296 |
| Molecular Formula | C27H63F9OSi8 |
| Molecular Weight | 799.47 g/mol |
| Exact Mass | 798.29 |
| IUPAC Name | tris[dimethyl(3,3,3-trifluoropropyl)silyl]-tris[ethyl(dimethyl)silyl]silyloxysilane |
| SMILES | CC[Si](C)(C)[Si](O[Si]([Si](C)(C)CCC(F)(F)F)([Si](C)(C)CCC(F)(F)F)[Si](C)(C)CCC(F)(F)F)([Si](C)(C)CC)[Si](C)(C)CC |
| InChI | InChI=1S/C27H63F9OSi8/c1-16-38(4,5)44(39(6,7)17-2,40(8,9)18-3)37-45(41(10,11)22-19-25(28,29)30,42(12,13)23-20-26(31,32)33)43(14,15)24-21-27(34,35)36/h16-24H2,1-15H3 |
| InChIKey | OGSWVGLCAWUYRO-UHFFFAOYSA-N |
| XLogP | 12.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 799.47 |
| LogP ≤ 5 | 12.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|