C24H35Cl2F3O4Si3 — CID 59325932
bis[[[4-(chloromethyl)phenyl]methoxy-dimethylsilyl]oxy]-methyl-(3,3,3-trifluoropropyl)silane (PubChem CID 59325932) has the molecular formula C24H35Cl2F3O4Si3 and a molecular weight of 599.70 g/mol. Its IUPAC name is bis[[[4-(chloromethyl)phenyl]methoxy-dimethylsilyl]oxy]-methyl-(3,3,3-trifluoropropyl)silane.
| Compound Name | bis[[[4-(chloromethyl)phenyl]methoxy-dimethylsilyl]oxy]-methyl-(3,3,3-trifluoropropyl)silane |
|---|---|
| PubChem CID | 59325932 |
| Molecular Formula | C24H35Cl2F3O4Si3 |
| Molecular Weight | 599.70 g/mol |
| Exact Mass | 598.12 |
| IUPAC Name | bis[[[4-(chloromethyl)phenyl]methoxy-dimethylsilyl]oxy]-methyl-(3,3,3-trifluoropropyl)silane |
| SMILES | C[Si](C)(OCc1ccc(CCl)cc1)O[Si](C)(CCC(F)(F)F)O[Si](C)(C)OCc1ccc(CCl)cc1 |
| InChI | InChI=1S/C24H35Cl2F3O4Si3/c1-34(2,30-18-22-10-6-20(16-25)7-11-22)32-36(5,15-14-24(27,28)29)33-35(3,4)31-19-23-12-8-21(17-26)9-13-23/h6-13H,14-19H2,1-5H3 |
| InChIKey | JVEODUHTDGGESZ-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.70 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|