C12H20F10OSi2 — CID 44717333
[dimethyl(3,3,4,4,4-pentafluorobutyl)silyl]oxy-dimethyl-(3,3,4,4,4-pentafluorobutyl)silane (PubChem CID 44717333) has the molecular formula C12H20F10OSi2 and a molecular weight of 426.44 g/mol. Its IUPAC name is [dimethyl(3,3,4,4,4-pentafluorobutyl)silyl]oxy-dimethyl-(3,3,4,4,4-pentafluorobutyl)silane.
| Compound Name | [dimethyl(3,3,4,4,4-pentafluorobutyl)silyl]oxy-dimethyl-(3,3,4,4,4-pentafluorobutyl)silane |
|---|---|
| PubChem CID | 44717333 |
| Molecular Formula | C12H20F10OSi2 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | [dimethyl(3,3,4,4,4-pentafluorobutyl)silyl]oxy-dimethyl-(3,3,4,4,4-pentafluorobutyl)silane |
| SMILES | C[Si](C)(CCC(F)(F)C(F)(F)F)O[Si](C)(C)CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H20F10OSi2/c1-24(2,7-5-9(13,14)11(17,18)19)23-25(3,4)8-6-10(15,16)12(20,21)22/h5-8H2,1-4H3 |
| InChIKey | OUJYZEUWIHNDJP-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|