C20H20F26OSi2 — CID 123504610
dimethyl-[methyl(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)silyl]oxy-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane (PubChem CID 123504610) has the molecular formula C20H20F26OSi2 and a molecular weight of 826.50 g/mol. Its IUPAC name is dimethyl-[methyl(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)silyl]oxy-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane.
| Compound Name | dimethyl-[methyl(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)silyl]oxy-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane |
|---|---|
| PubChem CID | 123504610 |
| Molecular Formula | C20H20F26OSi2 |
| Molecular Weight | 826.50 g/mol |
| Exact Mass | 826.06 |
| IUPAC Name | dimethyl-[methyl(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)silyl]oxy-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane |
| SMILES | C[SiH](CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)O[Si](C)(C)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H20F26OSi2/c1-48(7-4-5-9(21,22)11(25,26)13(29,30)15(33,34)17(37,38)19(41,42)43)47-49(2,3)8-6-10(23,24)12(27,28)14(31,32)16(35,36)18(39,40)20(44,45)46/h48H,4-8H2,1-3H3 |
| InChIKey | WKUUULPZIJOTMF-UHFFFAOYSA-N |
| XLogP | 11.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.50 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|