C10H20F6NSi2 — CID 18369893
CID 18369893 (PubChem CID 18369893) has the molecular formula C10H20F6NSi2 and a molecular weight of 324.44 g/mol.
| Compound Name | CID 18369893 |
|---|---|
| PubChem CID | 18369893 |
| Molecular Formula | C10H20F6NSi2 |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | — |
| SMILES | CN([Si](C)C)[Si](C)(CCC(F)(F)F)CCC(F)(F)F |
| InChI | InChI=1S/C10H20F6NSi2/c1-17(18(2)3)19(4,7-5-9(11,12)13)8-6-10(14,15)16/h5-8H2,1-4H3 |
| InChIKey | VLHZSTCYAPZPQS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|