C12H23F3O2Si — CID 22377678
cyclopentyl-diethoxy-(3,3,3-trifluoropropyl)silane (PubChem CID 22377678) has the molecular formula C12H23F3O2Si and a molecular weight of 284.39 g/mol. Its IUPAC name is cyclopentyl-diethoxy-(3,3,3-trifluoropropyl)silane.
| Compound Name | cyclopentyl-diethoxy-(3,3,3-trifluoropropyl)silane |
|---|---|
| PubChem CID | 22377678 |
| Molecular Formula | C12H23F3O2Si |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | cyclopentyl-diethoxy-(3,3,3-trifluoropropyl)silane |
| SMILES | CCO[Si](CCC(F)(F)F)(OCC)C1CCCC1 |
| InChI | InChI=1S/C12H23F3O2Si/c1-3-16-18(17-4-2,10-9-12(13,14)15)11-7-5-6-8-11/h11H,3-10H2,1-2H3 |
| InChIKey | OMQCVZDNBALSEV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|