C20H35F13O6Si2 — CID 159939837
triethoxysilane;triethoxy(1,1,2,2,3,3,4,4,5,5,8,8,8-tridecafluorooctyl)silane (PubChem CID 159939837) has the molecular formula C20H35F13O6Si2 and a molecular weight of 674.64 g/mol. Its IUPAC name is triethoxysilane;triethoxy(1,1,2,2,3,3,4,4,5,5,8,8,8-tridecafluorooctyl)silane.
| Compound Name | triethoxysilane;triethoxy(1,1,2,2,3,3,4,4,5,5,8,8,8-tridecafluorooctyl)silane |
|---|---|
| PubChem CID | 159939837 |
| Molecular Formula | C20H35F13O6Si2 |
| Molecular Weight | 674.64 g/mol |
| Exact Mass | 674.18 |
| IUPAC Name | triethoxysilane;triethoxy(1,1,2,2,3,3,4,4,5,5,8,8,8-tridecafluorooctyl)silane |
| SMILES | CCO[SiH](OCC)OCC.CCO[Si](OCC)(OCC)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCC(F)(F)F |
| InChI | InChI=1S/C14H19F13O3Si.C6H16O3Si/c1-4-28-31(29-5-2,30-6-3)14(26,27)13(24,25)12(22,23)11(20,21)9(15,16)7-8-10(17,18)19;1-4-7-10(8-5-2)9-6-3/h4-8H2,1-3H3;10H,4-6H2,1-3H3 |
| InChIKey | OASSEWBJCHRDKI-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.64 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|