C17H25F13O3Si — CID 175041903
diethoxy-methyl-(4,4,5,5,6,6,7,7,8,8,11,11,11-tridecafluoro-2-methylundecan-2-yl)oxysilane (PubChem CID 175041903) has the molecular formula C17H25F13O3Si and a molecular weight of 552.44 g/mol. Its IUPAC name is diethoxy-methyl-(4,4,5,5,6,6,7,7,8,8,11,11,11-tridecafluoro-2-methylundecan-2-yl)oxysilane.
| Compound Name | diethoxy-methyl-(4,4,5,5,6,6,7,7,8,8,11,11,11-tridecafluoro-2-methylundecan-2-yl)oxysilane |
|---|---|
| PubChem CID | 175041903 |
| Molecular Formula | C17H25F13O3Si |
| Molecular Weight | 552.44 g/mol |
| Exact Mass | 552.14 |
| IUPAC Name | diethoxy-methyl-(4,4,5,5,6,6,7,7,8,8,11,11,11-tridecafluoro-2-methylundecan-2-yl)oxysilane |
| SMILES | CCO[Si](C)(OCC)OC(C)(C)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCC(F)(F)F |
| InChI | InChI=1S/C17H25F13O3Si/c1-6-31-34(5,32-7-2)33-11(3,4)10-13(20,21)16(27,28)17(29,30)15(25,26)12(18,19)8-9-14(22,23)24/h6-10H2,1-5H3 |
| InChIKey | ZELARHJAOLXMPQ-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.44 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|