About bis(hex-1-ene);2-hydroxyethyl prop-2-enoate
bis(hex-1-ene);2-hydroxyethyl prop-2-enoate (PubChem CID 87914321) has the molecular formula C17H32O3
and a molecular weight of 284.44 g/mol. Its IUPAC name is bis(hex-1-ene);2-hydroxyethyl prop-2-enoate.
Molecular Properties
| Compound Name | bis(hex-1-ene);2-hydroxyethyl prop-2-enoate |
| PubChem CID | 87914321 |
| Molecular Formula | C17H32O3 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.24 |
| IUPAC Name | bis(hex-1-ene);2-hydroxyethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCO.C=CCCCC.C=CCCCC |
| InChI | InChI=1S/2C6H12.C5H8O3/c2*1-3-5-6-4-2;1-2-5(7)8-4-3-6/h2*3H,1,4-6H2,2H3;2,6H,1,3-4H2 |
| InChIKey | DKGVTKWEBXLZHK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis(hex-1-ene);2-hydroxyethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(hex-1-ene);2-hydroxyethyl prop-2-enoate?
The IUPAC name of bis(hex-1-ene);2-hydroxyethyl prop-2-enoate (CID 87914321) is bis(hex-1-ene);2-hydroxyethyl prop-2-enoate.
What is the SMILES notation for bis(hex-1-ene);2-hydroxyethyl prop-2-enoate?
The canonical SMILES for bis(hex-1-ene);2-hydroxyethyl prop-2-enoate is C=CC(=O)OCCO.C=CCCCC.C=CCCCC.
What is the InChIKey of bis(hex-1-ene);2-hydroxyethyl prop-2-enoate?
The InChIKey is DKGVTKWEBXLZHK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H12.C5H8O3/c2*1-3-5-6-4-2;1-2-5(7)8-4-3-6/h2*3H,1,4-6H2,2H3;2,6H,1,3-4H2.
What are the key properties of bis(hex-1-ene);2-hydroxyethyl prop-2-enoate?
bis(hex-1-ene);2-hydroxyethyl prop-2-enoate has a molecular weight of 284.44 g/mol, XLogP of 4.43, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(hex-1-ene);2-hydroxyethyl prop-2-enoate is sourced from PubChem (CID 87914321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).