C17H28O8 — CID 118092284
butyl prop-2-enoate;2-hydroxyethyl prop-2-enoate;methoxymethyl prop-2-enoate (PubChem CID 118092284) has the molecular formula C17H28O8 and a molecular weight of 360.40 g/mol. Its IUPAC name is butyl prop-2-enoate;2-hydroxyethyl prop-2-enoate;methoxymethyl prop-2-enoate.
| Compound Name | butyl prop-2-enoate;2-hydroxyethyl prop-2-enoate;methoxymethyl prop-2-enoate |
|---|---|
| PubChem CID | 118092284 |
| Molecular Formula | C17H28O8 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | butyl prop-2-enoate;2-hydroxyethyl prop-2-enoate;methoxymethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCC.C=CC(=O)OCCO.C=CC(=O)OCOC |
| InChI | InChI=1S/C7H12O2.2C5H8O3/c1-3-5-6-9-7(8)4-2;1-3-5(6)8-4-7-2;1-2-5(7)8-4-3-6/h4H,2-3,5-6H2,1H3;3H,1,4H2,2H3;2,6H,1,3-4H2 |
| InChIKey | ABYHYJIYSQNHSC-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|