C28H52N2O12 — CID 58978516
3-[3-(3-methoxypropoxy)propoxy]propyl 3-[2-[[3-[3-[3-(3-methoxypropoxy)propoxy]propoxy]-3-oxopropanoyl]amino]ethylamino]-3-oxopropanoate (PubChem CID 58978516) has the molecular formula C28H52N2O12 and a molecular weight of 608.73 g/mol. Its IUPAC name is 3-[3-(3-methoxypropoxy)propoxy]propyl 3-[2-[[3-[3-[3-(3-methoxypropoxy)propoxy]propoxy]-3-oxopropanoyl]amino]ethylamino]-3-oxopropanoate.
| Compound Name | 3-[3-(3-methoxypropoxy)propoxy]propyl 3-[2-[[3-[3-[3-(3-methoxypropoxy)propoxy]propoxy]-3-oxopropanoyl]amino]ethylamino]-3-oxopropanoate |
|---|---|
| PubChem CID | 58978516 |
| Molecular Formula | C28H52N2O12 |
| Molecular Weight | 608.73 g/mol |
| Exact Mass | 608.35 |
| IUPAC Name | 3-[3-(3-methoxypropoxy)propoxy]propyl 3-[2-[[3-[3-[3-(3-methoxypropoxy)propoxy]propoxy]-3-oxopropanoyl]amino]ethylamino]-3-oxopropanoate |
| SMILES | COCCCOCCCOCCCOC(=O)CC(=O)NCCNC(=O)CC(=O)OCCCOCCCOCCCOC |
| InChI | InChI=1S/C28H52N2O12/c1-35-11-3-13-37-15-5-17-39-19-7-21-41-27(33)23-25(31)29-9-10-30-26(32)24-28(34)42-22-8-20-40-18-6-16-38-14-4-12-36-2/h3-24H2,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | HWOVREUHKRUXKX-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 166.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.73 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|