About 3-methoxypropyl 3-oxopropanoate
3-methoxypropyl 3-oxopropanoate (PubChem CID 144975882) has the molecular formula C7H12O4
and a molecular weight of 160.17 g/mol. Its IUPAC name is 3-methoxypropyl 3-oxopropanoate.
Molecular Properties
| Compound Name | 3-methoxypropyl 3-oxopropanoate |
| PubChem CID | 144975882 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 3-methoxypropyl 3-oxopropanoate |
| SMILES | COCCCOC(=O)CC=O |
| InChI | InChI=1S/C7H12O4/c1-10-5-2-6-11-7(9)3-4-8/h4H,2-3,5-6H2,1H3 |
| InChIKey | SZPFFUZHDLLYLD-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxypropyl 3-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxypropyl 3-oxopropanoate?
The IUPAC name of 3-methoxypropyl 3-oxopropanoate (CID 144975882) is 3-methoxypropyl 3-oxopropanoate.
What is the SMILES notation for 3-methoxypropyl 3-oxopropanoate?
The canonical SMILES for 3-methoxypropyl 3-oxopropanoate is COCCCOC(=O)CC=O.
What is the InChIKey of 3-methoxypropyl 3-oxopropanoate?
The InChIKey is SZPFFUZHDLLYLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O4/c1-10-5-2-6-11-7(9)3-4-8/h4H,2-3,5-6H2,1H3.
What are the key properties of 3-methoxypropyl 3-oxopropanoate?
3-methoxypropyl 3-oxopropanoate has a molecular weight of 160.17 g/mol, XLogP of 0.16, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxypropyl 3-oxopropanoate is sourced from PubChem (CID 144975882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).