About 3-methoxypropyl 3-methylpentanoate
3-methoxypropyl 3-methylpentanoate (PubChem CID 87360755) has the molecular formula C10H20O3
and a molecular weight of 188.27 g/mol. Its IUPAC name is 3-methoxypropyl 3-methylpentanoate.
Molecular Properties
| Compound Name | 3-methoxypropyl 3-methylpentanoate |
| PubChem CID | 87360755 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | 3-methoxypropyl 3-methylpentanoate |
| SMILES | CCC(C)CC(=O)OCCCOC |
| InChI | InChI=1S/C10H20O3/c1-4-9(2)8-10(11)13-7-5-6-12-3/h9H,4-8H2,1-3H3 |
| InChIKey | NEPLOYRBSFYDLX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxypropyl 3-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxypropyl 3-methylpentanoate?
The IUPAC name of 3-methoxypropyl 3-methylpentanoate (CID 87360755) is 3-methoxypropyl 3-methylpentanoate.
What is the SMILES notation for 3-methoxypropyl 3-methylpentanoate?
The canonical SMILES for 3-methoxypropyl 3-methylpentanoate is CCC(C)CC(=O)OCCCOC.
What is the InChIKey of 3-methoxypropyl 3-methylpentanoate?
The InChIKey is NEPLOYRBSFYDLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O3/c1-4-9(2)8-10(11)13-7-5-6-12-3/h9H,4-8H2,1-3H3.
What are the key properties of 3-methoxypropyl 3-methylpentanoate?
3-methoxypropyl 3-methylpentanoate has a molecular weight of 188.27 g/mol, XLogP of 2.00, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxypropyl 3-methylpentanoate is sourced from PubChem (CID 87360755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).