About 5-[3-[butyl(methyl)amino]propoxy]pentyl 3-methylpentanoate
5-[3-[butyl(methyl)amino]propoxy]pentyl 3-methylpentanoate (PubChem CID 143222357) has the molecular formula C19H39NO3
and a molecular weight of 329.53 g/mol. Its IUPAC name is 5-[3-[butyl(methyl)amino]propoxy]pentyl 3-methylpentanoate.
Molecular Properties
| Compound Name | 5-[3-[butyl(methyl)amino]propoxy]pentyl 3-methylpentanoate |
| PubChem CID | 143222357 |
| Molecular Formula | C19H39NO3 |
| Molecular Weight | 329.53 g/mol |
| Exact Mass | 329.29 |
| IUPAC Name | 5-[3-[butyl(methyl)amino]propoxy]pentyl 3-methylpentanoate |
| SMILES | CCCCN(C)CCCOCCCCCOC(=O)CC(C)CC |
| InChI | InChI=1S/C19H39NO3/c1-5-7-12-20(4)13-11-15-22-14-9-8-10-16-23-19(21)17-18(3)6-2/h18H,5-17H2,1-4H3 |
| InChIKey | VYVOXTKPDXZADE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.53 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[3-[butyl(methyl)amino]propoxy]pentyl 3-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-[butyl(methyl)amino]propoxy]pentyl 3-methylpentanoate?
The IUPAC name of 5-[3-[butyl(methyl)amino]propoxy]pentyl 3-methylpentanoate (CID 143222357) is 5-[3-[butyl(methyl)amino]propoxy]pentyl 3-methylpentanoate.
What is the SMILES notation for 5-[3-[butyl(methyl)amino]propoxy]pentyl 3-methylpentanoate?
The canonical SMILES for 5-[3-[butyl(methyl)amino]propoxy]pentyl 3-methylpentanoate is CCCCN(C)CCCOCCCCCOC(=O)CC(C)CC.
What is the InChIKey of 5-[3-[butyl(methyl)amino]propoxy]pentyl 3-methylpentanoate?
The InChIKey is VYVOXTKPDXZADE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H39NO3/c1-5-7-12-20(4)13-11-15-22-14-9-8-10-16-23-19(21)17-18(3)6-2/h18H,5-17H2,1-4H3.
What are the key properties of 5-[3-[butyl(methyl)amino]propoxy]pentyl 3-methylpentanoate?
5-[3-[butyl(methyl)amino]propoxy]pentyl 3-methylpentanoate has a molecular weight of 329.53 g/mol, XLogP of 4.27, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-[butyl(methyl)amino]propoxy]pentyl 3-methylpentanoate is sourced from PubChem (CID 143222357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).