C11H19NO5 — CID 58159450
methyl 3-oxo-3-[2-(4-oxopentoxy)ethylamino]propanoate (PubChem CID 58159450) has the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. Its IUPAC name is methyl 3-oxo-3-[2-(4-oxopentoxy)ethylamino]propanoate.
| Compound Name | methyl 3-oxo-3-[2-(4-oxopentoxy)ethylamino]propanoate |
|---|---|
| PubChem CID | 58159450 |
| Molecular Formula | C11H19NO5 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | methyl 3-oxo-3-[2-(4-oxopentoxy)ethylamino]propanoate |
| SMILES | COC(=O)CC(=O)NCCOCCCC(C)=O |
| InChI | InChI=1S/C11H19NO5/c1-9(13)4-3-6-17-7-5-12-10(14)8-11(15)16-2/h3-8H2,1-2H3,(H,12,14) |
| InChIKey | UFLRYXFJMNTALE-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|