C24H38O9 — CID 101392875
2-[2-[2-[2-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxy)ethoxy]ethoxy]ethoxy]ethyl 2,2,5-trimethyl-1,3-dioxane-5-carboxylate (PubChem CID 101392875) has the molecular formula C24H38O9 and a molecular weight of 470.56 g/mol. Its IUPAC name is 2-[2-[2-[2-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxy)ethoxy]ethoxy]ethoxy]ethyl 2,2,5-trimethyl-1,3-dioxane-5-carboxylate.
| Compound Name | 2-[2-[2-[2-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxy)ethoxy]ethoxy]ethoxy]ethyl 2,2,5-trimethyl-1,3-dioxane-5-carboxylate |
|---|---|
| PubChem CID | 101392875 |
| Molecular Formula | C24H38O9 |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 2-[2-[2-[2-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxy)ethoxy]ethoxy]ethoxy]ethyl 2,2,5-trimethyl-1,3-dioxane-5-carboxylate |
| SMILES | CC1(C)OCC(C)(C(=O)OCCOCCOCCOCCOC(=O)C2CC3C=CC2C3)CO1 |
| InChI | InChI=1S/C24H38O9/c1-23(2)32-16-24(3,17-33-23)22(26)31-13-11-29-9-7-27-6-8-28-10-12-30-21(25)20-15-18-4-5-19(20)14-18/h4-5,18-20H,6-17H2,1-3H3 |
| InChIKey | HUYCHDASTCVUKJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|