C11H18O5 — CID 162932286
methyl 3,6-dihydroxy-7-methyl-1,3,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyran-4-carboxylate (PubChem CID 162932286) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is methyl 3,6-dihydroxy-7-methyl-1,3,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyran-4-carboxylate.
| Compound Name | methyl 3,6-dihydroxy-7-methyl-1,3,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyran-4-carboxylate |
|---|---|
| PubChem CID | 162932286 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | methyl 3,6-dihydroxy-7-methyl-1,3,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyran-4-carboxylate |
| SMILES | COC(=O)C1C(O)OCC2C(C)C(O)CC21 |
| InChI | InChI=1S/C11H18O5/c1-5-7-4-16-11(14)9(10(13)15-2)6(7)3-8(5)12/h5-9,11-12,14H,3-4H2,1-2H3 |
| InChIKey | NBJRYDDSTNUCAJ-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |