C9H14O3 — CID 59319777
methyl (3S)-3-methyl-7-oxabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 59319777) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is methyl (3S)-3-methyl-7-oxabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | methyl (3S)-3-methyl-7-oxabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 59319777 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | methyl (3S)-3-methyl-7-oxabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | COC(=O)C1C2CCC(O2)[C@H]1C |
| InChI | InChI=1S/C9H14O3/c1-5-6-3-4-7(12-6)8(5)9(10)11-2/h5-8H,3-4H2,1-2H3/t5-,6?,7?,8?/m1/s1 |
| InChIKey | ONYIJNIXGSAGMY-NIYQRSRNSA-N |
| XLogP | 0.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |