About 3-O-[[ethoxy(methyl)phosphoryl]oxymethyl] 2-O-methyl 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate
3-O-[[ethoxy(methyl)phosphoryl]oxymethyl] 2-O-methyl 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate (PubChem CID 122537113) has the molecular formula C13H21O8P
and a molecular weight of 336.28 g/mol. Its IUPAC name is 3-O-[[ethoxy(methyl)phosphoryl]oxymethyl] 2-O-methyl 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate.
Molecular Properties
| Compound Name | 3-O-[[ethoxy(methyl)phosphoryl]oxymethyl] 2-O-methyl 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate |
| PubChem CID | 122537113 |
| Molecular Formula | C13H21O8P |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 3-O-[[ethoxy(methyl)phosphoryl]oxymethyl] 2-O-methyl 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate |
| SMILES | CCOP(C)(=O)OCOC(=O)C1C2CCC(O2)C1C(=O)OC |
| InChI | InChI=1S/C13H21O8P/c1-4-19-22(3,16)20-7-18-13(15)11-9-6-5-8(21-9)10(11)12(14)17-2/h8-11H,4-7H2,1-3H3 |
| InChIKey | OYZVVGXPAKDSAM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-O-[[ethoxy(methyl)phosphoryl]oxymethyl] 2-O-methyl 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-[[ethoxy(methyl)phosphoryl]oxymethyl] 2-O-methyl 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate?
The IUPAC name of 3-O-[[ethoxy(methyl)phosphoryl]oxymethyl] 2-O-methyl 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate (CID 122537113) is 3-O-[[ethoxy(methyl)phosphoryl]oxymethyl] 2-O-methyl 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate.
What is the SMILES notation for 3-O-[[ethoxy(methyl)phosphoryl]oxymethyl] 2-O-methyl 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate?
The canonical SMILES for 3-O-[[ethoxy(methyl)phosphoryl]oxymethyl] 2-O-methyl 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate is CCOP(C)(=O)OCOC(=O)C1C2CCC(O2)C1C(=O)OC.
What is the InChIKey of 3-O-[[ethoxy(methyl)phosphoryl]oxymethyl] 2-O-methyl 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate?
The InChIKey is OYZVVGXPAKDSAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21O8P/c1-4-19-22(3,16)20-7-18-13(15)11-9-6-5-8(21-9)10(11)12(14)17-2/h8-11H,4-7H2,1-3H3.
What are the key properties of 3-O-[[ethoxy(methyl)phosphoryl]oxymethyl] 2-O-methyl 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate?
3-O-[[ethoxy(methyl)phosphoryl]oxymethyl] 2-O-methyl 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate has a molecular weight of 336.28 g/mol, XLogP of 1.33, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-[[ethoxy(methyl)phosphoryl]oxymethyl] 2-O-methyl 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate is sourced from PubChem (CID 122537113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).