C17H26NO7P — CID 118351684
ethyl 3-[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)ethyl-ethoxyphosphoryl]propanoate (PubChem CID 118351684) has the molecular formula C17H26NO7P and a molecular weight of 387.37 g/mol. Its IUPAC name is ethyl 3-[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)ethyl-ethoxyphosphoryl]propanoate.
| Compound Name | ethyl 3-[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)ethyl-ethoxyphosphoryl]propanoate |
|---|---|
| PubChem CID | 118351684 |
| Molecular Formula | C17H26NO7P |
| Molecular Weight | 387.37 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | ethyl 3-[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)ethyl-ethoxyphosphoryl]propanoate |
| SMILES | CCOC(=O)CCP(=O)(CCN1C(=O)C2C3CCC(O3)C2C1=O)OCC |
| InChI | InChI=1S/C17H26NO7P/c1-3-23-13(19)7-9-26(22,24-4-2)10-8-18-16(20)14-11-5-6-12(25-11)15(14)17(18)21/h11-12,14-15H,3-10H2,1-2H3 |
| InChIKey | RNYCDUHXPAUZAB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|