C17H28ClN3O4 — CID 119570743
N-[3-(aminomethyl)pentan-3-yl]-3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)propanamide;hydrochloride (PubChem CID 119570743) has the molecular formula C17H28ClN3O4 and a molecular weight of 373.88 g/mol. Its IUPAC name is N-[3-(aminomethyl)pentan-3-yl]-3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)propanamide;hydrochloride.
| Compound Name | N-[3-(aminomethyl)pentan-3-yl]-3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119570743 |
| Molecular Formula | C17H28ClN3O4 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | N-[3-(aminomethyl)pentan-3-yl]-3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)propanamide;hydrochloride |
| SMILES | CCC(CC)(CN)NC(=O)CCN1C(=O)C2C3CCC(O3)C2C1=O.Cl |
| InChI | InChI=1S/C17H27N3O4.ClH/c1-3-17(4-2,9-18)19-12(21)7-8-20-15(22)13-10-5-6-11(24-10)14(13)16(20)23;/h10-11,13-14H,3-9,18H2,1-2H3,(H,19,21);1H |
| InChIKey | DDUHZESFFMAMNP-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|