C17H19N3O4 — CID 119422458
N-(2-aminophenyl)-3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)propanamide (PubChem CID 119422458) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is N-(2-aminophenyl)-3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)propanamide.
| Compound Name | N-(2-aminophenyl)-3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 119422458 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | N-(2-aminophenyl)-3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)propanamide |
| SMILES | Nc1ccccc1NC(=O)CCN1C(=O)C2C3CCC(O3)C2C1=O |
| InChI | InChI=1S/C17H19N3O4/c18-9-3-1-2-4-10(9)19-13(21)7-8-20-16(22)14-11-5-6-12(24-11)15(14)17(20)23/h1-4,11-12,14-15H,5-8,18H2,(H,19,21) |
| InChIKey | WCBQOIRVAORXGZ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|