C26H32N4O10 — CID 91242690
dimethyl 4,7-bis[(2-ethoxy-2-oxoethyl)carbamoyl]-5,6-diazatetracyclo[8.2.2.02,9.03,8]tetradeca-3(8),5,13-triene-11,12-dicarboxylate (PubChem CID 91242690) has the molecular formula C26H32N4O10 and a molecular weight of 560.56 g/mol. Its IUPAC name is dimethyl 4,7-bis[(2-ethoxy-2-oxoethyl)carbamoyl]-5,6-diazatetracyclo[8.2.2.02,9.03,8]tetradeca-3(8),5,13-triene-11,12-dicarboxylate.
| Compound Name | dimethyl 4,7-bis[(2-ethoxy-2-oxoethyl)carbamoyl]-5,6-diazatetracyclo[8.2.2.02,9.03,8]tetradeca-3(8),5,13-triene-11,12-dicarboxylate |
|---|---|
| PubChem CID | 91242690 |
| Molecular Formula | C26H32N4O10 |
| Molecular Weight | 560.56 g/mol |
| Exact Mass | 560.21 |
| IUPAC Name | dimethyl 4,7-bis[(2-ethoxy-2-oxoethyl)carbamoyl]-5,6-diazatetracyclo[8.2.2.02,9.03,8]tetradeca-3(8),5,13-triene-11,12-dicarboxylate |
| SMILES | CCOC(=O)CNC(=O)C1N=NC(C(=O)NCC(=O)OCC)C2=C1C1C3C=CC(C(C(=O)OC)C3C(=O)OC)C21 |
| InChI | InChI=1S/C26H32N4O10/c1-5-39-13(31)9-27-23(33)21-19-15-11-7-8-12(18(26(36)38-4)17(11)25(35)37-3)16(15)20(19)22(30-29-21)24(34)28-10-14(32)40-6-2/h7-8,11-12,15-18,21-22H,5-6,9-10H2,1-4H3,(H,27,33)(H,28,34) |
| InChIKey | RIEYFHGIDZBSFM-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 188.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.56 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|