C38H38O8 — CID 129431361
tetramethyl (1R,2R,3S,4R,7R,8R,9S,10R,11R,12S)-4,7-dimethyl-15,16-diphenylpentacyclo[8.2.2.24,7.02,9.03,8]hexadeca-5,13,15-triene-5,6,11,12-tetracarboxylate (PubChem CID 129431361) has the molecular formula C38H38O8 and a molecular weight of 622.71 g/mol. Its IUPAC name is tetramethyl (1R,2R,3S,4R,7R,8R,9S,10R,11R,12S)-4,7-dimethyl-15,16-diphenylpentacyclo[8.2.2.24,7.02,9.03,8]hexadeca-5,13,15-triene-5,6,11,12-tetracarboxylate.
| Compound Name | tetramethyl (1R,2R,3S,4R,7R,8R,9S,10R,11R,12S)-4,7-dimethyl-15,16-diphenylpentacyclo[8.2.2.24,7.02,9.03,8]hexadeca-5,13,15-triene-5,6,11,12-tetracarboxylate |
|---|---|
| PubChem CID | 129431361 |
| Molecular Formula | C38H38O8 |
| Molecular Weight | 622.71 g/mol |
| Exact Mass | 622.26 |
| IUPAC Name | tetramethyl (1R,2R,3S,4R,7R,8R,9S,10R,11R,12S)-4,7-dimethyl-15,16-diphenylpentacyclo[8.2.2.24,7.02,9.03,8]hexadeca-5,13,15-triene-5,6,11,12-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@]2(C)C(c3ccccc3)=C(c3ccccc3)[C@@]1(C)[C@@H]1[C@@H]3[C@H]4C=C[C@@H]([C@H](C(=O)OC)[C@@H]4C(=O)OC)[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C38H38O8/c1-37-27(19-13-9-7-10-14-19)28(20-15-11-8-12-16-20)38(2,32(36(42)46-6)31(37)35(41)45-5)30-24-22-18-17-21(23(24)29(30)37)25(33(39)43-3)26(22)34(40)44-4/h7-18,21-26,29-30H,1-6H3/t21-,22-,23-,24+,25-,26+,29-,30+,37+,38+/m1/s1 |
| InChIKey | KQRZUBATBISGIJ-FVDDESBTSA-N |
| XLogP | 5.15 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.71 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|