C8H10N2O4 — CID 115071536
methyl 3-(aminomethyl)-2,4-dioxo-3-azabicyclo[3.1.0]hexane-6-carboxylate (PubChem CID 115071536) has the molecular formula C8H10N2O4 and a molecular weight of 198.18 g/mol. Its IUPAC name is methyl 3-(aminomethyl)-2,4-dioxo-3-azabicyclo[3.1.0]hexane-6-carboxylate.
| Compound Name | methyl 3-(aminomethyl)-2,4-dioxo-3-azabicyclo[3.1.0]hexane-6-carboxylate |
|---|---|
| PubChem CID | 115071536 |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | methyl 3-(aminomethyl)-2,4-dioxo-3-azabicyclo[3.1.0]hexane-6-carboxylate |
| SMILES | COC(=O)C1C2C(=O)N(CN)C(=O)C12 |
| InChI | InChI=1S/C8H10N2O4/c1-14-8(13)5-3-4(5)7(12)10(2-9)6(3)11/h3-5H,2,9H2,1H3 |
| InChIKey | AOVXBZSXOZTRMI-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|