C30H40N2O8 — CID 100863455
methyl (2R,6S)-4-[6-[(2S,6R)-1-methoxycarbonyl-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undecan-4-yl]hexyl]-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undecane-1-carboxylate (PubChem CID 100863455) has the molecular formula C30H40N2O8 and a molecular weight of 556.66 g/mol. Its IUPAC name is methyl (2R,6S)-4-[6-[(2S,6R)-1-methoxycarbonyl-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undecan-4-yl]hexyl]-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undecane-1-carboxylate.
| Compound Name | methyl (2R,6S)-4-[6-[(2S,6R)-1-methoxycarbonyl-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undecan-4-yl]hexyl]-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undecane-1-carboxylate |
|---|---|
| PubChem CID | 100863455 |
| Molecular Formula | C30H40N2O8 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | methyl (2R,6S)-4-[6-[(2S,6R)-1-methoxycarbonyl-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undecan-4-yl]hexyl]-3,5-dioxo-4-azatricyclo[5.2.2.02,6]undecane-1-carboxylate |
| SMILES | COC(=O)C12CCC(CC1)[C@@H]1C(=O)N(CCCCCCN3C(=O)[C@@H]4C5CCC(C(=O)OC)(CC5)[C@H]4C3=O)C(=O)[C@H]12 |
| InChI | InChI=1S/C30H40N2O8/c1-39-27(37)29-11-7-17(8-12-29)19-21(29)25(35)31(23(19)33)15-5-3-4-6-16-32-24(34)20-18-9-13-30(14-10-18,28(38)40-2)22(20)26(32)36/h17-22H,3-16H2,1-2H3/t17?,18?,19-,20+,21-,22+,29?,30? |
| InChIKey | ADLRANCHRAKKIO-YFAFEQFXSA-N |
| XLogP | 2.48 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|