C23H29NO5 — CID 123642606
benzyl 3-[1-(2-hydroxyethyl)azepane-4-carbonyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 123642606) has the molecular formula C23H29NO5 and a molecular weight of 399.49 g/mol. Its IUPAC name is benzyl 3-[1-(2-hydroxyethyl)azepane-4-carbonyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | benzyl 3-[1-(2-hydroxyethyl)azepane-4-carbonyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 123642606 |
| Molecular Formula | C23H29NO5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | benzyl 3-[1-(2-hydroxyethyl)azepane-4-carbonyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)C1C2C=CC(O2)C1C(=O)C1CCCN(CCO)CC1 |
| InChI | InChI=1S/C23H29NO5/c25-14-13-24-11-4-7-17(10-12-24)22(26)20-18-8-9-19(29-18)21(20)23(27)28-15-16-5-2-1-3-6-16/h1-3,5-6,8-9,17-21,25H,4,7,10-15H2 |
| InChIKey | UJZINVAUGRMZNU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|