C18H24N2O4 — CID 112545077
1-cyclobutyl-5-(phenylmethoxycarbonylamino)piperidine-3-carboxylic acid (PubChem CID 112545077) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is 1-cyclobutyl-5-(phenylmethoxycarbonylamino)piperidine-3-carboxylic acid.
| Compound Name | 1-cyclobutyl-5-(phenylmethoxycarbonylamino)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 112545077 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 1-cyclobutyl-5-(phenylmethoxycarbonylamino)piperidine-3-carboxylic acid |
| SMILES | O=C(NC1CC(C(=O)O)CN(C2CCC2)C1)OCc1ccccc1 |
| InChI | InChI=1S/C18H24N2O4/c21-17(22)14-9-15(11-20(10-14)16-7-4-8-16)19-18(23)24-12-13-5-2-1-3-6-13/h1-3,5-6,14-16H,4,7-12H2,(H,19,23)(H,21,22) |
| InChIKey | RTSLSTRYJKIZSX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |