C15H9FN2O2 — CID 76798885
5-fluoro-3-(3H-furo[3,4-c]pyridin-1-ylidene)-1H-indol-2-one (PubChem CID 76798885) has the molecular formula C15H9FN2O2 and a molecular weight of 268.25 g/mol. Its IUPAC name is 5-fluoro-3-(3H-furo[3,4-c]pyridin-1-ylidene)-1H-indol-2-one.
| Compound Name | 5-fluoro-3-(3H-furo[3,4-c]pyridin-1-ylidene)-1H-indol-2-one |
|---|---|
| PubChem CID | 76798885 |
| Molecular Formula | C15H9FN2O2 |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 5-fluoro-3-(3H-furo[3,4-c]pyridin-1-ylidene)-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(F)cc2C1=C1OCc2cnccc21 |
| InChI | InChI=1S/C15H9FN2O2/c16-9-1-2-12-11(5-9)13(15(19)18-12)14-10-3-4-17-6-8(10)7-20-14/h1-6H,7H2,(H,18,19) |
| InChIKey | VYGCFHQWVXKGOT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|