C24H25FN2O3 — CID 118000473
(3E)-3-[4-[1-(3,3-dimethylbutanoyl)pyrrol-2-yl]-5,5-dimethylfuran-2-ylidene]-6-fluoro-1H-indol-2-one (PubChem CID 118000473) has the molecular formula C24H25FN2O3 and a molecular weight of 408.47 g/mol. Its IUPAC name is (3E)-3-[4-[1-(3,3-dimethylbutanoyl)pyrrol-2-yl]-5,5-dimethylfuran-2-ylidene]-6-fluoro-1H-indol-2-one.
| Compound Name | (3E)-3-[4-[1-(3,3-dimethylbutanoyl)pyrrol-2-yl]-5,5-dimethylfuran-2-ylidene]-6-fluoro-1H-indol-2-one |
|---|---|
| PubChem CID | 118000473 |
| Molecular Formula | C24H25FN2O3 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | (3E)-3-[4-[1-(3,3-dimethylbutanoyl)pyrrol-2-yl]-5,5-dimethylfuran-2-ylidene]-6-fluoro-1H-indol-2-one |
| SMILES | CC(C)(C)CC(=O)n1cccc1C1=C/C(=C2\C(=O)Nc3cc(F)ccc32)OC1(C)C |
| InChI | InChI=1S/C24H25FN2O3/c1-23(2,3)13-20(28)27-10-6-7-18(27)16-12-19(30-24(16,4)5)21-15-9-8-14(25)11-17(15)26-22(21)29/h6-12H,13H2,1-5H3,(H,26,29)/b21-19+ |
| InChIKey | HWJPMIYLLYXZIE-XUTLUUPISA-N |
| XLogP | 5.26 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|