C27H31FN2O4S — CID 118002121
3-[[4-[(5E)-5-(6-fluoro-2-oxo-1H-indol-3-ylidene)-2,2-dimethylfuran-3-yl]phenyl]methyl-methylamino]pentane-1-sulfinic acid (PubChem CID 118002121) has the molecular formula C27H31FN2O4S and a molecular weight of 498.62 g/mol. Its IUPAC name is 3-[[4-[(5E)-5-(6-fluoro-2-oxo-1H-indol-3-ylidene)-2,2-dimethylfuran-3-yl]phenyl]methyl-methylamino]pentane-1-sulfinic acid.
| Compound Name | 3-[[4-[(5E)-5-(6-fluoro-2-oxo-1H-indol-3-ylidene)-2,2-dimethylfuran-3-yl]phenyl]methyl-methylamino]pentane-1-sulfinic acid |
|---|---|
| PubChem CID | 118002121 |
| Molecular Formula | C27H31FN2O4S |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 3-[[4-[(5E)-5-(6-fluoro-2-oxo-1H-indol-3-ylidene)-2,2-dimethylfuran-3-yl]phenyl]methyl-methylamino]pentane-1-sulfinic acid |
| SMILES | CCC(CCS(=O)O)N(C)Cc1ccc(C2=C/C(=C3\C(=O)Nc4cc(F)ccc43)OC2(C)C)cc1 |
| InChI | InChI=1S/C27H31FN2O4S/c1-5-20(12-13-35(32)33)30(4)16-17-6-8-18(9-7-17)22-15-24(34-27(22,2)3)25-21-11-10-19(28)14-23(21)29-26(25)31/h6-11,14-15,20H,5,12-13,16H2,1-4H3,(H,29,31)(H,32,33)/b25-24+ |
| InChIKey | DFRPHSFIKLNXFK-OCOZRVBESA-N |
| XLogP | 5.20 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|