C10H14N6 — CID 106750886
4-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]benzene-1,2,4-triamine (PubChem CID 106750886) has the molecular formula C10H14N6 and a molecular weight of 218.26 g/mol. Its IUPAC name is 4-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]benzene-1,2,4-triamine.
| Compound Name | 4-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 106750886 |
| Molecular Formula | C10H14N6 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 4-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]benzene-1,2,4-triamine |
| SMILES | Nc1ccc(NCCc2ncn[nH]2)cc1N |
| InChI | InChI=1S/C10H14N6/c11-8-2-1-7(5-9(8)12)13-4-3-10-14-6-15-16-10/h1-2,5-6,13H,3-4,11-12H2,(H,14,15,16) |
| InChIKey | HCGFYMQUEOMEPX-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|