C13H14N6 — CID 83060979
4-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]quinoline-4,8-diamine (PubChem CID 83060979) has the molecular formula C13H14N6 and a molecular weight of 254.30 g/mol. Its IUPAC name is 4-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]quinoline-4,8-diamine.
| Compound Name | 4-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]quinoline-4,8-diamine |
|---|---|
| PubChem CID | 83060979 |
| Molecular Formula | C13H14N6 |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 4-N-[2-(1H-1,2,4-triazol-5-yl)ethyl]quinoline-4,8-diamine |
| SMILES | Nc1cccc2c(NCCc3ncn[nH]3)ccnc12 |
| InChI | InChI=1S/C13H14N6/c14-10-3-1-2-9-11(4-6-16-13(9)10)15-7-5-12-17-8-18-19-12/h1-4,6,8H,5,7,14H2,(H,15,16)(H,17,18,19) |
| InChIKey | YTGACYYKKDNLQP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|