C15H17N5 — CID 106104004
4-N-[2-(1-methylpyrazol-3-yl)ethyl]quinoline-4,8-diamine (PubChem CID 106104004) has the molecular formula C15H17N5 and a molecular weight of 267.34 g/mol. Its IUPAC name is 4-N-[2-(1-methylpyrazol-3-yl)ethyl]quinoline-4,8-diamine.
| Compound Name | 4-N-[2-(1-methylpyrazol-3-yl)ethyl]quinoline-4,8-diamine |
|---|---|
| PubChem CID | 106104004 |
| Molecular Formula | C15H17N5 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 4-N-[2-(1-methylpyrazol-3-yl)ethyl]quinoline-4,8-diamine |
| SMILES | Cn1ccc(CCNc2ccnc3c(N)cccc23)n1 |
| InChI | InChI=1S/C15H17N5/c1-20-10-7-11(19-20)5-8-17-14-6-9-18-15-12(14)3-2-4-13(15)16/h2-4,6-7,9-10H,5,8,16H2,1H3,(H,17,18) |
| InChIKey | MVDPSFKPMMVBKT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|