C13H20Cl2N4O — CID 102757385
2-[butyl-[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]acetamide (PubChem CID 102757385) has the molecular formula C13H20Cl2N4O and a molecular weight of 319.24 g/mol. Its IUPAC name is 2-[butyl-[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]acetamide.
| Compound Name | 2-[butyl-[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]acetamide |
|---|---|
| PubChem CID | 102757385 |
| Molecular Formula | C13H20Cl2N4O |
| Molecular Weight | 319.24 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 2-[butyl-[3,5-dichloro-6-(ethylamino)-2-pyridinyl]amino]acetamide |
| SMILES | CCCCN(CC(N)=O)c1nc(NCC)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H20Cl2N4O/c1-3-5-6-19(8-11(16)20)13-10(15)7-9(14)12(18-13)17-4-2/h7H,3-6,8H2,1-2H3,(H2,16,20)(H,17,18) |
| InChIKey | GXFPIAWVASNEIU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.24 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |