C13H21N5O3 — CID 80788637
2-[butyl-[6-(ethylamino)-3-nitro-2-pyridinyl]amino]acetamide (PubChem CID 80788637) has the molecular formula C13H21N5O3 and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-[butyl-[6-(ethylamino)-3-nitro-2-pyridinyl]amino]acetamide.
| Compound Name | 2-[butyl-[6-(ethylamino)-3-nitro-2-pyridinyl]amino]acetamide |
|---|---|
| PubChem CID | 80788637 |
| Molecular Formula | C13H21N5O3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 2-[butyl-[6-(ethylamino)-3-nitro-2-pyridinyl]amino]acetamide |
| SMILES | CCCCN(CC(N)=O)c1nc(NCC)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H21N5O3/c1-3-5-8-17(9-11(14)19)13-10(18(20)21)6-7-12(16-13)15-4-2/h6-7H,3-5,8-9H2,1-2H3,(H2,14,19)(H,15,16) |
| InChIKey | GORSQKHOQBJKLX-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 114.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|