C14H25N5O2 — CID 80796707
2-N-[2-(dimethylamino)ethyl]-6-N-ethyl-3-nitro-2-N-propylpyridine-2,6-diamine (PubChem CID 80796707) has the molecular formula C14H25N5O2 and a molecular weight of 295.39 g/mol. Its IUPAC name is 2-N-[2-(dimethylamino)ethyl]-6-N-ethyl-3-nitro-2-N-propylpyridine-2,6-diamine.
| Compound Name | 2-N-[2-(dimethylamino)ethyl]-6-N-ethyl-3-nitro-2-N-propylpyridine-2,6-diamine |
|---|---|
| PubChem CID | 80796707 |
| Molecular Formula | C14H25N5O2 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | 2-N-[2-(dimethylamino)ethyl]-6-N-ethyl-3-nitro-2-N-propylpyridine-2,6-diamine |
| SMILES | CCCN(CCN(C)C)c1nc(NCC)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H25N5O2/c1-5-9-18(11-10-17(3)4)14-12(19(20)21)7-8-13(16-14)15-6-2/h7-8H,5-6,9-11H2,1-4H3,(H,15,16) |
| InChIKey | MBHLNWNFXMXZOH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 74.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|