C9H11ClN4O3 — CID 103103661
2-[(6-chloro-3-nitro-2-pyridinyl)-ethylamino]acetamide (PubChem CID 103103661) has the molecular formula C9H11ClN4O3 and a molecular weight of 258.66 g/mol. Its IUPAC name is 2-[(6-chloro-3-nitro-2-pyridinyl)-ethylamino]acetamide.
| Compound Name | 2-[(6-chloro-3-nitro-2-pyridinyl)-ethylamino]acetamide |
|---|---|
| PubChem CID | 103103661 |
| Molecular Formula | C9H11ClN4O3 |
| Molecular Weight | 258.66 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 2-[(6-chloro-3-nitro-2-pyridinyl)-ethylamino]acetamide |
| SMILES | CCN(CC(N)=O)c1nc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H11ClN4O3/c1-2-13(5-8(11)15)9-6(14(16)17)3-4-7(10)12-9/h3-4H,2,5H2,1H3,(H2,11,15) |
| InChIKey | MIPITUMXGTVYOF-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 102.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.66 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|