C14H23ClN4O — CID 62890626
2-[butyl-[[3-chloro-6-(ethylamino)-2-pyridinyl]methyl]amino]acetamide (PubChem CID 62890626) has the molecular formula C14H23ClN4O and a molecular weight of 298.82 g/mol. Its IUPAC name is 2-[butyl-[[3-chloro-6-(ethylamino)-2-pyridinyl]methyl]amino]acetamide.
| Compound Name | 2-[butyl-[[3-chloro-6-(ethylamino)-2-pyridinyl]methyl]amino]acetamide |
|---|---|
| PubChem CID | 62890626 |
| Molecular Formula | C14H23ClN4O |
| Molecular Weight | 298.82 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | 2-[butyl-[[3-chloro-6-(ethylamino)-2-pyridinyl]methyl]amino]acetamide |
| SMILES | CCCCN(CC(N)=O)Cc1nc(NCC)ccc1Cl |
| InChI | InChI=1S/C14H23ClN4O/c1-3-5-8-19(10-13(16)20)9-12-11(15)6-7-14(18-12)17-4-2/h6-7H,3-5,8-10H2,1-2H3,(H2,16,20)(H,17,18) |
| InChIKey | DWHHTALKLSLLQL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.82 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |