C14H24ClN3 — CID 62891121
5-chloro-6-[(dipropylamino)methyl]-N-ethylpyridin-2-amine (PubChem CID 62891121) has the molecular formula C14H24ClN3 and a molecular weight of 269.82 g/mol. Its IUPAC name is 5-chloro-6-[(dipropylamino)methyl]-N-ethylpyridin-2-amine.
| Compound Name | 5-chloro-6-[(dipropylamino)methyl]-N-ethylpyridin-2-amine |
|---|---|
| PubChem CID | 62891121 |
| Molecular Formula | C14H24ClN3 |
| Molecular Weight | 269.82 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 5-chloro-6-[(dipropylamino)methyl]-N-ethylpyridin-2-amine |
| SMILES | CCCN(CCC)Cc1nc(NCC)ccc1Cl |
| InChI | InChI=1S/C14H24ClN3/c1-4-9-18(10-5-2)11-13-12(15)7-8-14(17-13)16-6-3/h7-8H,4-6,9-11H2,1-3H3,(H,16,17) |
| InChIKey | LQDZONRMGWKWBE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.82 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |